C21H20 — CID 158122819
1-[1,1-bis(4-deuteriophenyl)ethyl]-4-methylbenzene (PubChem CID 158122819) has the molecular formula C21H20 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-[1,1-bis(4-deuteriophenyl)ethyl]-4-methylbenzene.
| Compound Name | 1-[1,1-bis(4-deuteriophenyl)ethyl]-4-methylbenzene |
|---|---|
| PubChem CID | 158122819 |
| Molecular Formula | C21H20 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[1,1-bis(4-deuteriophenyl)ethyl]-4-methylbenzene |
| SMILES | [2H]c1ccc(C(C)(c2ccc([2H])cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H20/c1-17-13-15-20(16-14-17)21(2,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16H,1-2H3/i3D,4D |
| InChIKey | DRNAKIHWPNJCQF-NMQOAUCRSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|