C23H24NO4- — CID 163733614
1-[2-[4-[(4-methoxyphenoxy)-oxidoamino]oxyphenyl]propan-2-yl]-4-methylbenzene (PubChem CID 163733614) has the molecular formula C23H24NO4- and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-[2-[4-[(4-methoxyphenoxy)-oxidoamino]oxyphenyl]propan-2-yl]-4-methylbenzene.
| Compound Name | 1-[2-[4-[(4-methoxyphenoxy)-oxidoamino]oxyphenyl]propan-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 163733614 |
| Molecular Formula | C23H24NO4- |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-[2-[4-[(4-methoxyphenoxy)-oxidoamino]oxyphenyl]propan-2-yl]-4-methylbenzene |
| SMILES | COc1ccc(ON([O-])Oc2ccc(C(C)(C)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H24NO4/c1-17-5-7-18(8-6-17)23(2,3)19-9-11-21(12-10-19)27-24(25)28-22-15-13-20(26-4)14-16-22/h5-16H,1-4H3/q-1 |
| InChIKey | RIQHITVXCNZAEF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|