C28H38O4 — CID 122691271
1-[4-[3,3,5-trimethyl-1-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexyl]phenoxy]butan-2-ol (PubChem CID 122691271) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is 1-[4-[3,3,5-trimethyl-1-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexyl]phenoxy]butan-2-ol.
| Compound Name | 1-[4-[3,3,5-trimethyl-1-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexyl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 122691271 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 1-[4-[3,3,5-trimethyl-1-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexyl]phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1ccc(C2(c3ccc(OCC4CO4)cc3)CC(C)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C28H38O4/c1-5-23(29)16-30-24-10-6-21(7-11-24)28(15-20(2)14-27(3,4)19-28)22-8-12-25(13-9-22)31-17-26-18-32-26/h6-13,20,23,26,29H,5,14-19H2,1-4H3 |
| InChIKey | VEMXDBBKWOZVRF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|