C53H52O7 — CID 59148737
1,3-bis[4-[6-methyl-1-[4-(oxiran-2-ylmethoxy)phenyl]-2,3-dihydroinden-1-yl]phenoxy]propan-2-ol (PubChem CID 59148737) has the molecular formula C53H52O7 and a molecular weight of 800.99 g/mol. Its IUPAC name is 1,3-bis[4-[6-methyl-1-[4-(oxiran-2-ylmethoxy)phenyl]-2,3-dihydroinden-1-yl]phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[4-[6-methyl-1-[4-(oxiran-2-ylmethoxy)phenyl]-2,3-dihydroinden-1-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 59148737 |
| Molecular Formula | C53H52O7 |
| Molecular Weight | 800.99 g/mol |
| Exact Mass | 800.37 |
| IUPAC Name | 1,3-bis[4-[6-methyl-1-[4-(oxiran-2-ylmethoxy)phenyl]-2,3-dihydroinden-1-yl]phenoxy]propan-2-ol |
| SMILES | Cc1ccc2c(c1)C(c1ccc(OCC(O)COc3ccc(C4(c5ccc(OCC6CO6)cc5)CCc5ccc(C)cc54)cc3)cc1)(c1ccc(OCC3CO3)cc1)CC2 |
| InChI | InChI=1S/C53H52O7/c1-35-3-5-37-23-25-52(50(37)27-35,41-11-19-46(20-12-41)57-31-48-33-59-48)39-7-15-44(16-8-39)55-29-43(54)30-56-45-17-9-40(10-18-45)53(26-24-38-6-4-36(2)28-51(38)53)42-13-21-47(22-14-42)58-32-49-34-60-49/h3-22,27-28,43,48-49,54H,23-26,29-34H2,1-2H3 |
| InChIKey | ZOLCEKDCXMDBLN-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.99 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|