C34H34O5S2 — CID 90144573
1-[4-[[4-(thiiran-2-ylmethoxy)phenyl]methyl]phenoxy]-3-[4-[[4-(thiiran-2-yloxy)phenyl]methyl]phenoxy]propan-2-ol (PubChem CID 90144573) has the molecular formula C34H34O5S2 and a molecular weight of 586.78 g/mol. Its IUPAC name is 1-[4-[[4-(thiiran-2-ylmethoxy)phenyl]methyl]phenoxy]-3-[4-[[4-(thiiran-2-yloxy)phenyl]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[4-[[4-(thiiran-2-ylmethoxy)phenyl]methyl]phenoxy]-3-[4-[[4-(thiiran-2-yloxy)phenyl]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 90144573 |
| Molecular Formula | C34H34O5S2 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 1-[4-[[4-(thiiran-2-ylmethoxy)phenyl]methyl]phenoxy]-3-[4-[[4-(thiiran-2-yloxy)phenyl]methyl]phenoxy]propan-2-ol |
| SMILES | OC(COc1ccc(Cc2ccc(OCC3CS3)cc2)cc1)COc1ccc(Cc2ccc(OC3CS3)cc2)cc1 |
| InChI | InChI=1S/C34H34O5S2/c35-28(20-37-30-11-3-25(4-12-30)18-27-7-15-32(16-8-27)39-34-23-41-34)19-36-29-9-1-24(2-10-29)17-26-5-13-31(14-6-26)38-21-33-22-40-33/h1-16,28,33-35H,17-23H2 |
| InChIKey | YTZQZHMIZLCZKK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|