C39H42O6 — CID 148553711
[2-[4-[1-[4-(oxiran-2-ylmethoxy)phenyl]-1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]cyclopropyl]methanol (PubChem CID 148553711) has the molecular formula C39H42O6 and a molecular weight of 606.76 g/mol. Its IUPAC name is [2-[4-[1-[4-(oxiran-2-ylmethoxy)phenyl]-1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]cyclopropyl]methanol.
| Compound Name | [2-[4-[1-[4-(oxiran-2-ylmethoxy)phenyl]-1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]cyclopropyl]methanol |
|---|---|
| PubChem CID | 148553711 |
| Molecular Formula | C39H42O6 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | [2-[4-[1-[4-(oxiran-2-ylmethoxy)phenyl]-1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]cyclopropyl]methanol |
| SMILES | CC(C)(c1ccc(OCC2CO2)cc1)c1ccc(C(C)(c2ccc(OCC3CO3)cc2)c2ccc(OC3CC3CO)cc2)cc1 |
| InChI | InChI=1S/C39H42O6/c1-38(2,28-8-14-32(15-9-28)41-22-35-24-43-35)27-4-6-29(7-5-27)39(3,30-10-16-33(17-11-30)42-23-36-25-44-36)31-12-18-34(19-13-31)45-37-20-26(37)21-40/h4-19,26,35-37,40H,20-25H2,1-3H3 |
| InChIKey | MTQPDKOQGNYUCO-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|