C38H40O6 — CID 87592763
2-[[4-[2-[4-[1,1-bis[2-(oxiran-2-ylmethoxy)phenyl]ethyl]phenyl]propan-2-yl]phenoxy]methyl]oxirane (PubChem CID 87592763) has the molecular formula C38H40O6 and a molecular weight of 592.73 g/mol. Its IUPAC name is 2-[[4-[2-[4-[1,1-bis[2-(oxiran-2-ylmethoxy)phenyl]ethyl]phenyl]propan-2-yl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[2-[4-[1,1-bis[2-(oxiran-2-ylmethoxy)phenyl]ethyl]phenyl]propan-2-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87592763 |
| Molecular Formula | C38H40O6 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 2-[[4-[2-[4-[1,1-bis[2-(oxiran-2-ylmethoxy)phenyl]ethyl]phenyl]propan-2-yl]phenoxy]methyl]oxirane |
| SMILES | CC(C)(c1ccc(OCC2CO2)cc1)c1ccc(C(C)(c2ccccc2OCC2CO2)c2ccccc2OCC2CO2)cc1 |
| InChI | InChI=1S/C38H40O6/c1-37(2,27-16-18-29(19-17-27)39-20-30-21-40-30)26-12-14-28(15-13-26)38(3,33-8-4-6-10-35(33)43-24-31-22-41-31)34-9-5-7-11-36(34)44-25-32-23-42-32/h4-19,30-32H,20-25H2,1-3H3 |
| InChIKey | QZOMWJTUKCCQMK-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|