C37H34O3 — CID 153368265
(2R)-2-[[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]methyl]oxirane (PubChem CID 153368265) has the molecular formula C37H34O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is (2R)-2-[[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]methyl]oxirane.
| Compound Name | (2R)-2-[[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 153368265 |
| Molecular Formula | C37H34O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | (2R)-2-[[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]methyl]oxirane |
| SMILES | CC(C)(c1ccc(OC[C@H]2CO2)cc1)c1ccc(OC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H34O3/c1-36(2,28-18-22-33(23-19-28)38-26-35-27-39-35)29-20-24-34(25-21-29)40-37(30-12-6-3-7-13-30,31-14-8-4-9-15-31)32-16-10-5-11-17-32/h3-25,35H,26-27H2,1-2H3/t35-/m0/s1 |
| InChIKey | TYWQNCWURJVQRO-DHUJRADRSA-N |
| XLogP | 8.16 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|