C33H30Cl2N4O4 — CID 101252366
(4-chlorophenyl)-[5-[2-[3-[(4-chlorophenyl)diazenyl]-4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]-2-(oxiran-2-ylmethoxy)phenyl]diazene (PubChem CID 101252366) has the molecular formula C33H30Cl2N4O4 and a molecular weight of 617.53 g/mol. Its IUPAC name is (4-chlorophenyl)-[5-[2-[3-[(4-chlorophenyl)diazenyl]-4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]-2-(oxiran-2-ylmethoxy)phenyl]diazene.
| Compound Name | (4-chlorophenyl)-[5-[2-[3-[(4-chlorophenyl)diazenyl]-4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]-2-(oxiran-2-ylmethoxy)phenyl]diazene |
|---|---|
| PubChem CID | 101252366 |
| Molecular Formula | C33H30Cl2N4O4 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | (4-chlorophenyl)-[5-[2-[3-[(4-chlorophenyl)diazenyl]-4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]-2-(oxiran-2-ylmethoxy)phenyl]diazene |
| SMILES | CC(C)(c1ccc(OCC2CO2)c(/N=N/c2ccc(Cl)cc2)c1)c1ccc(OCC2CO2)c(/N=N/c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C33H30Cl2N4O4/c1-33(2,21-3-13-31(42-19-27-17-40-27)29(15-21)38-36-25-9-5-23(34)6-10-25)22-4-14-32(43-20-28-18-41-28)30(16-22)39-37-26-11-7-24(35)8-12-26/h3-16,27-28H,17-20H2,1-2H3/b38-36+,39-37+ |
| InChIKey | JMXLIWXIGIQJOJ-NFSGFYSESA-N |
| XLogP | 9.71 |
| TPSA | 92.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|