C30H44O7Si — CID 90233850
triethoxy-[3-[2-(oxiran-2-ylmethoxy)-5-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]propyl]silane (PubChem CID 90233850) has the molecular formula C30H44O7Si and a molecular weight of 544.76 g/mol. Its IUPAC name is triethoxy-[3-[2-(oxiran-2-ylmethoxy)-5-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]propyl]silane.
| Compound Name | triethoxy-[3-[2-(oxiran-2-ylmethoxy)-5-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]propyl]silane |
|---|---|
| PubChem CID | 90233850 |
| Molecular Formula | C30H44O7Si |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | triethoxy-[3-[2-(oxiran-2-ylmethoxy)-5-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]propyl]silane |
| SMILES | CCO[Si](CCCc1cc(C(C)(C)c2ccc(OCC3CO3)cc2)ccc1OCC1CO1)(OCC)OCC |
| InChI | InChI=1S/C30H44O7Si/c1-6-35-38(36-7-2,37-8-3)17-9-10-23-18-25(13-16-29(23)34-22-28-21-33-28)30(4,5)24-11-14-26(15-12-24)31-19-27-20-32-27/h11-16,18,27-28H,6-10,17,19-22H2,1-5H3 |
| InChIKey | HAJMFTOCPVNDBH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|