C31H48O6Si3 — CID 158570112
bis(dimethylsilyloxy)-dimethylsilane;2-[[4-[[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]methyl]-2-prop-2-enylphenoxy]methyl]oxirane (PubChem CID 158570112) has the molecular formula C31H48O6Si3 and a molecular weight of 600.98 g/mol. Its IUPAC name is bis(dimethylsilyloxy)-dimethylsilane;2-[[4-[[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]methyl]-2-prop-2-enylphenoxy]methyl]oxirane.
| Compound Name | bis(dimethylsilyloxy)-dimethylsilane;2-[[4-[[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]methyl]-2-prop-2-enylphenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 158570112 |
| Molecular Formula | C31H48O6Si3 |
| Molecular Weight | 600.98 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | bis(dimethylsilyloxy)-dimethylsilane;2-[[4-[[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]methyl]-2-prop-2-enylphenoxy]methyl]oxirane |
| SMILES | C=CCc1cc(Cc2ccc(OCC3CO3)c(CC=C)c2)ccc1OCC1CO1.C[SiH](C)O[Si](C)(C)O[SiH](C)C |
| InChI | InChI=1S/C25H28O4.C6H20O2Si3/c1-3-5-20-12-18(7-9-24(20)28-16-22-14-26-22)11-19-8-10-25(21(13-19)6-4-2)29-17-23-15-27-23;1-9(2)7-11(5,6)8-10(3)4/h3-4,7-10,12-13,22-23H,1-2,5-6,11,14-17H2;9-10H,1-6H3 |
| InChIKey | HRYYJYKEGHPRPC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.98 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|