C14H17ClO3 — CID 58165318
2-[3-chloro-4-(oxiran-2-ylmethoxy)phenyl]-3,3-dimethyloxetane (PubChem CID 58165318) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is 2-[3-chloro-4-(oxiran-2-ylmethoxy)phenyl]-3,3-dimethyloxetane.
| Compound Name | 2-[3-chloro-4-(oxiran-2-ylmethoxy)phenyl]-3,3-dimethyloxetane |
|---|---|
| PubChem CID | 58165318 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-[3-chloro-4-(oxiran-2-ylmethoxy)phenyl]-3,3-dimethyloxetane |
| SMILES | CC1(C)COC1c1ccc(OCC2CO2)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClO3/c1-14(2)8-18-13(14)9-3-4-12(11(15)5-9)17-7-10-6-16-10/h3-5,10,13H,6-8H2,1-2H3 |
| InChIKey | NEEYLHRFCJMHFO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|