C9H10F2N2O4S — CID 82919002
3-(2,4-difluoro-6-sulfamoylphenoxy)propanamide (PubChem CID 82919002) has the molecular formula C9H10F2N2O4S and a molecular weight of 280.25 g/mol. Its IUPAC name is 3-(2,4-difluoro-6-sulfamoylphenoxy)propanamide.
| Compound Name | 3-(2,4-difluoro-6-sulfamoylphenoxy)propanamide |
|---|---|
| PubChem CID | 82919002 |
| Molecular Formula | C9H10F2N2O4S |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3-(2,4-difluoro-6-sulfamoylphenoxy)propanamide |
| SMILES | NC(=O)CCOc1c(F)cc(F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H10F2N2O4S/c10-5-3-6(11)9(17-2-1-8(12)14)7(4-5)18(13,15)16/h3-4H,1-2H2,(H2,12,14)(H2,13,15,16) |
| InChIKey | GNVAEWDVFNJAOJ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |