C11H14F2N2O5S — CID 82915817
2-(2,4-difluoro-6-sulfamoylphenoxy)-N-(2-methoxyethyl)acetamide (PubChem CID 82915817) has the molecular formula C11H14F2N2O5S and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-(2,4-difluoro-6-sulfamoylphenoxy)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(2,4-difluoro-6-sulfamoylphenoxy)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 82915817 |
| Molecular Formula | C11H14F2N2O5S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-(2,4-difluoro-6-sulfamoylphenoxy)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1c(F)cc(F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H14F2N2O5S/c1-19-3-2-15-10(16)6-20-11-8(13)4-7(12)5-9(11)21(14,17)18/h4-5H,2-3,6H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | SFBAYKAKUULFTE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|