C15H23F2N — CID 114059600
2-(2,3-difluorophenyl)-N-propylhexan-3-amine (PubChem CID 114059600) has the molecular formula C15H23F2N and a molecular weight of 255.35 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-N-propylhexan-3-amine.
| Compound Name | 2-(2,3-difluorophenyl)-N-propylhexan-3-amine |
|---|---|
| PubChem CID | 114059600 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-(2,3-difluorophenyl)-N-propylhexan-3-amine |
| SMILES | CCCNC(CCC)C(C)c1cccc(F)c1F |
| InChI | InChI=1S/C15H23F2N/c1-4-7-14(18-10-5-2)11(3)12-8-6-9-13(16)15(12)17/h6,8-9,11,14,18H,4-5,7,10H2,1-3H3 |
| InChIKey | NRCAOGQKXMOFMK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |