C15H23F2N — CID 176658999
2-(2,3-difluorophenyl)-N-ethenylpentan-1-amine;ethane (PubChem CID 176658999) has the molecular formula C15H23F2N and a molecular weight of 255.35 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-N-ethenylpentan-1-amine;ethane.
| Compound Name | 2-(2,3-difluorophenyl)-N-ethenylpentan-1-amine;ethane |
|---|---|
| PubChem CID | 176658999 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-(2,3-difluorophenyl)-N-ethenylpentan-1-amine;ethane |
| SMILES | C=CNCC(CCC)c1cccc(F)c1F.CC |
| InChI | InChI=1S/C13H17F2N.C2H6/c1-3-6-10(9-16-4-2)11-7-5-8-12(14)13(11)15;1-2/h4-5,7-8,10,16H,2-3,6,9H2,1H3;1-2H3 |
| InChIKey | DTYZLYDUGAJFGY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |