C16H28ClNO4 — CID 17209007
3-propan-2-yloxy-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine;hydrochloride (PubChem CID 17209007) has the molecular formula C16H28ClNO4 and a molecular weight of 333.86 g/mol. Its IUPAC name is 3-propan-2-yloxy-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-propan-2-yloxy-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17209007 |
| Molecular Formula | C16H28ClNO4 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-propan-2-yloxy-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine;hydrochloride |
| SMILES | COc1ccc(CNCCCOC(C)C)c(OC)c1OC.Cl |
| InChI | InChI=1S/C16H27NO4.ClH/c1-12(2)21-10-6-9-17-11-13-7-8-14(18-3)16(20-5)15(13)19-4;/h7-8,12,17H,6,9-11H2,1-5H3;1H |
| InChIKey | ABQOMRMTEVGVQG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|