C20H26N2O2 — CID 56676258
2-(cyclohexen-1-yl)-N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]ethanamine (PubChem CID 56676258) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]ethanamine.
| Compound Name | 2-(cyclohexen-1-yl)-N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 56676258 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]ethanamine |
| SMILES | CCOc1ccc(-c2nc(CNCCC3=CCCCC3)co2)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-2-23-19-10-8-17(9-11-19)20-22-18(15-24-20)14-21-13-12-16-6-4-3-5-7-16/h6,8-11,15,21H,2-5,7,12-14H2,1H3 |
| InChIKey | IHLZRGYRCHFIEW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|