C17H21N3 — CID 43766350
2-(cyclohexen-1-yl)-N-(quinoxalin-2-ylmethyl)ethanamine (PubChem CID 43766350) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-(quinoxalin-2-ylmethyl)ethanamine.
| Compound Name | 2-(cyclohexen-1-yl)-N-(quinoxalin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 43766350 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-(quinoxalin-2-ylmethyl)ethanamine |
| SMILES | C1=C(CCNCc2cnc3ccccc3n2)CCCC1 |
| InChI | InChI=1S/C17H21N3/c1-2-6-14(7-3-1)10-11-18-12-15-13-19-16-8-4-5-9-17(16)20-15/h4-6,8-9,13,18H,1-3,7,10-12H2 |
| InChIKey | ZTMGVOVPNXDKPS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|