C20H21N3O4 — CID 3812541
2-(4-aminophenyl)-N-[2-(2,5-dimethoxyphenyl)ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 3812541) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[2-(2,5-dimethoxyphenyl)ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(4-aminophenyl)-N-[2-(2,5-dimethoxyphenyl)ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3812541 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-(4-aminophenyl)-N-[2-(2,5-dimethoxyphenyl)ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(CCNC(=O)c2coc(-c3ccc(N)cc3)n2)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-25-16-7-8-18(26-2)14(11-16)9-10-22-19(24)17-12-27-20(23-17)13-3-5-15(21)6-4-13/h3-8,11-12H,9-10,21H2,1-2H3,(H,22,24) |
| InChIKey | LROAVBZPTYUDBT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|