C19H20N2O2 — CID 56661731
N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N-methylaniline (PubChem CID 56661731) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N-methylaniline.
| Compound Name | N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N-methylaniline |
|---|---|
| PubChem CID | 56661731 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N-methylaniline |
| SMILES | CCOc1ccccc1-c1nc(CN(C)c2ccccc2)co1 |
| InChI | InChI=1S/C19H20N2O2/c1-3-22-18-12-8-7-11-17(18)19-20-15(14-23-19)13-21(2)16-9-5-4-6-10-16/h4-12,14H,3,13H2,1-2H3 |
| InChIKey | WKQRQLMRLTYZBW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |