C19H33IN6OS — CID 111717713
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-4-methylpentyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111717713) has the molecular formula C19H33IN6OS and a molecular weight of 520.49 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-4-methylpentyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-4-methylpentyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111717713 |
| Molecular Formula | C19H33IN6OS |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-4-methylpentyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCOC(CCN/C(=N\Cc1nnc(C)n1C)NCc1cccs1)C(C)C.I |
| InChI | InChI=1S/C19H32N6OS.HI/c1-6-26-17(14(2)3)9-10-20-19(21-12-16-8-7-11-27-16)22-13-18-24-23-15(4)25(18)5;/h7-8,11,14,17H,6,9-10,12-13H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | WDLPZEJQEFGGPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|