C21H29IN6O2S — CID 111215174
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111215174) has the molecular formula C21H29IN6O2S and a molecular weight of 556.47 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111215174 |
| Molecular Formula | C21H29IN6O2S |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(=N/Cc2nnc(C)n2C)NCc2cccs2)cc1OC.I |
| InChI | InChI=1S/C21H28N6O2S.HI/c1-15-25-26-20(27(15)2)14-24-21(23-13-17-6-5-11-30-17)22-10-9-16-7-8-18(28-3)19(12-16)29-4;/h5-8,11-12H,9-10,13-14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | WYWIDRATOQLAKY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|