C22H26N8S — CID 111864046
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(4-pyrazol-1-ylphenyl)ethyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111864046) has the molecular formula C22H26N8S and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(4-pyrazol-1-ylphenyl)ethyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(4-pyrazol-1-ylphenyl)ethyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111864046 |
| Molecular Formula | C22H26N8S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(4-pyrazol-1-ylphenyl)ethyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(/NCCc2ccc(-n3cccn3)cc2)NCc2cccs2)n1C |
| InChI | InChI=1S/C22H26N8S/c1-17-27-28-21(29(17)2)16-25-22(24-15-20-5-3-14-31-20)23-12-10-18-6-8-19(9-7-18)30-13-4-11-26-30/h3-9,11,13-14H,10,12,15-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | PLBJKURNOFLFAO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|