C21H32N6O2 — CID 111516605
N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 111516605) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111516605 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCOC(C)c1noc(CN/C(=N\C)N2CCN(Cc3cccc(C)c3)CC2)n1 |
| InChI | InChI=1S/C21H32N6O2/c1-5-28-17(3)20-24-19(29-25-20)14-23-21(22-4)27-11-9-26(10-12-27)15-18-8-6-7-16(2)13-18/h6-8,13,17H,5,9-12,14-15H2,1-4H3,(H,22,23) |
| InChIKey | PDFLHZJOOLQSAZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|