C20H30ClIN6O2 — CID 111513725
4-(5-chloro-2-methylphenyl)-N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111513725) has the molecular formula C20H30ClIN6O2 and a molecular weight of 548.86 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111513725 |
| Molecular Formula | C20H30ClIN6O2 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOC(C)c1noc(CN/C(=N\C)N2CCN(c3cc(Cl)ccc3C)CC2)n1.I |
| InChI | InChI=1S/C20H29ClN6O2.HI/c1-5-28-15(3)19-24-18(29-25-19)13-23-20(22-4)27-10-8-26(9-11-27)17-12-16(21)7-6-14(17)2;/h6-7,12,15H,5,8-11,13H2,1-4H3,(H,22,23);1H |
| InChIKey | QHLABEJFBCITPY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|