C18H26N6O4 — CID 111511387
N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111511387) has the molecular formula C18H26N6O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111511387 |
| Molecular Formula | C18H26N6O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCOC(C)c1noc(CN/C(=N\C)N2CCN(C(=O)c3ccco3)CC2)n1 |
| InChI | InChI=1S/C18H26N6O4/c1-4-26-13(2)16-21-15(28-22-16)12-20-18(19-3)24-9-7-23(8-10-24)17(25)14-6-5-11-27-14/h5-6,11,13H,4,7-10,12H2,1-3H3,(H,19,20) |
| InChIKey | FGVZVHGISNDILA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|