C20H31IN6O3 — CID 111514483
N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111514483) has the molecular formula C20H31IN6O3 and a molecular weight of 530.41 g/mol. Its IUPAC name is N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111514483 |
| Molecular Formula | C20H31IN6O3 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOC(C)c1noc(CN/C(=N\C)N2CCN(c3cccc(OC)c3)CC2)n1.I |
| InChI | InChI=1S/C20H30N6O3.HI/c1-5-28-15(2)19-23-18(29-24-19)14-22-20(21-3)26-11-9-25(10-12-26)16-7-6-8-17(13-16)27-4;/h6-8,13,15H,5,9-12,14H2,1-4H3,(H,21,22);1H |
| InChIKey | KLYVKPFKIVAPKQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|