C14H21N5O2S — CID 111513626
1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111513626) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111513626 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCOC(C)c1noc(CN/C(=N/C)NCc2cccs2)n1 |
| InChI | InChI=1S/C14H21N5O2S/c1-4-20-10(2)13-18-12(21-19-13)9-17-14(15-3)16-8-11-6-5-7-22-11/h5-7,10H,4,8-9H2,1-3H3,(H2,15,16,17) |
| InChIKey | VIAMTJYFZNDUHG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|