C18H37IN6O2 — CID 111509836
1-[5-(diethylamino)pentan-2-yl]-3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111509836) has the molecular formula C18H37IN6O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111509836 |
| Molecular Formula | C18H37IN6O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOC(C)c1noc(CN/C(=N/C)NC(C)CCCN(CC)CC)n1.I |
| InChI | InChI=1S/C18H36N6O2.HI/c1-7-24(8-2)12-10-11-14(4)21-18(19-6)20-13-16-22-17(23-26-16)15(5)25-9-3;/h14-15H,7-13H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | OYIYZAKQPPURLW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|