C15H30N6 — CID 110999861
1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 110999861) has the molecular formula C15H30N6 and a molecular weight of 294.45 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110999861 |
| Molecular Formula | C15H30N6 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCc1ccn[nH]1 |
| InChI | InChI=1S/C15H30N6/c1-5-21(6-2)11-7-8-13(3)19-15(16-4)17-12-14-9-10-18-20-14/h9-10,13H,5-8,11-12H2,1-4H3,(H,18,20)(H2,16,17,19) |
| InChIKey | DFINLSIPBCIZTP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|