C18H28IN5O3 — CID 111516376
1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111516376) has the molecular formula C18H28IN5O3 and a molecular weight of 489.36 g/mol. Its IUPAC name is 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111516376 |
| Molecular Formula | C18H28IN5O3 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOC(C)c1noc(CN/C(=N\C)NCCc2ccccc2OC)n1.I |
| InChI | InChI=1S/C18H27N5O3.HI/c1-5-25-13(2)17-22-16(26-23-17)12-21-18(19-3)20-11-10-14-8-6-7-9-15(14)24-4;/h6-9,13H,5,10-12H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | WYIXJPMHIILPJZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|