C20H28IN7O2 — CID 111527832
1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111527832) has the molecular formula C20H28IN7O2 and a molecular weight of 525.40 g/mol. Its IUPAC name is 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111527832 |
| Molecular Formula | C20H28IN7O2 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCOC(C)c1noc(CN/C(=N\C)NCCc2ccc(-n3cccn3)cc2)n1.I |
| InChI | InChI=1S/C20H27N7O2.HI/c1-4-28-15(2)19-25-18(29-26-19)14-23-20(21-3)22-12-10-16-6-8-17(9-7-16)27-13-5-11-24-27;/h5-9,11,13,15H,4,10,12,14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | XDUHCQPKQNEZPT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|