C16H27N3S2 — CID 109485302
2-ethyl-N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)thiomorpholine-4-carboximidamide (PubChem CID 109485302) has the molecular formula C16H27N3S2 and a molecular weight of 325.55 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)thiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485302 |
| Molecular Formula | C16H27N3S2 |
| Molecular Weight | 325.55 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-ethyl-N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)thiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCC(C)(C)c2cccs2)CCS1 |
| InChI | InChI=1S/C16H27N3S2/c1-5-13-11-19(8-10-20-13)15(17-4)18-12-16(2,3)14-7-6-9-21-14/h6-7,9,13H,5,8,10-12H2,1-4H3,(H,17,18) |
| InChIKey | XRHAPLIAFHZEQE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|