C17H24N6O4 — CID 109461706
1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine (PubChem CID 109461706) has the molecular formula C17H24N6O4 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine.
| Compound Name | 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109461706 |
| Molecular Formula | C17H24N6O4 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCn1cc([N+](=O)[O-])cn1)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C17H24N6O4/c1-18-17(19-7-8-22-13-15(12-20-22)23(24)25)21-14-5-3-6-16(11-14)27-10-4-9-26-2/h3,5-6,11-13H,4,7-10H2,1-2H3,(H2,18,19,21) |
| InChIKey | LQOOBVAUGSFCFH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|