C22H31IN4O4 — CID 109461855
4-methoxy-N-[2-[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 109461855) has the molecular formula C22H31IN4O4 and a molecular weight of 542.42 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 4-methoxy-N-[2-[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109461855 |
| Molecular Formula | C22H31IN4O4 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | 4-methoxy-N-[2-[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(OC)cc1)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C22H30N4O4.HI/c1-23-22(26-18-6-4-7-20(16-18)30-15-5-14-28-2)25-13-12-24-21(27)17-8-10-19(29-3)11-9-17;/h4,6-11,16H,5,12-15H2,1-3H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | ZSRHSCUORSTCAQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|