C22H30FIN4O3 — CID 109460435
2-(4-fluorophenyl)-N-[2-[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 109460435) has the molecular formula C22H30FIN4O3 and a molecular weight of 544.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109460435 |
| Molecular Formula | C22H30FIN4O3 |
| Molecular Weight | 544.41 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)Cc1ccc(F)cc1)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C22H29FN4O3.HI/c1-24-22(27-19-5-3-6-20(16-19)30-14-4-13-29-2)26-12-11-25-21(28)15-17-7-9-18(23)10-8-17;/h3,5-10,16H,4,11-15H2,1-2H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | PNASRXLTQQJKHR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|