C13H21N3O2 — CID 109462402
1-[3-(3-methoxypropoxy)phenyl]-2,3-dimethylguanidine (PubChem CID 109462402) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[3-(3-methoxypropoxy)phenyl]-2,3-dimethylguanidine.
| Compound Name | 1-[3-(3-methoxypropoxy)phenyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 109462402 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-[3-(3-methoxypropoxy)phenyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C13H21N3O2/c1-14-13(15-2)16-11-6-4-7-12(10-11)18-9-5-8-17-3/h4,6-7,10H,5,8-9H2,1-3H3,(H2,14,15,16) |
| InChIKey | DTCDOKYTQCKGKS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|