C19H22F4IN3O2 — CID 109460271
1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 109460271) has the molecular formula C19H22F4IN3O2 and a molecular weight of 527.30 g/mol. Its IUPAC name is 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109460271 |
| Molecular Formula | C19H22F4IN3O2 |
| Molecular Weight | 527.30 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(F)c(F)cc(F)c1F)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C19H21F4N3O2.HI/c1-24-19(25-11-14-17(22)15(20)10-16(21)18(14)23)26-12-5-3-6-13(9-12)28-8-4-7-27-2;/h3,5-6,9-10H,4,7-8,11H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | MFAILATVEQIPGL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|