C18H31N5O3 — CID 111716884
1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine (PubChem CID 111716884) has the molecular formula C18H31N5O3 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine.
| Compound Name | 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 111716884 |
| Molecular Formula | C18H31N5O3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine |
| SMILES | CCOC(CCN/C(=N\C)NCCNc1ccc([N+](=O)[O-])cc1)C(C)C |
| InChI | InChI=1S/C18H31N5O3/c1-5-26-17(14(2)3)10-11-21-18(19-4)22-13-12-20-15-6-8-16(9-7-15)23(24)25/h6-9,14,17,20H,5,10-13H2,1-4H3,(H2,19,21,22) |
| InChIKey | HKRGHDOPACDHIY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|