C13H29N3O3S — CID 111716954
1-(3-ethoxy-4-methylpentyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine (PubChem CID 111716954) has the molecular formula C13H29N3O3S and a molecular weight of 307.46 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine.
| Compound Name | 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111716954 |
| Molecular Formula | C13H29N3O3S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine |
| SMILES | CCOC(CCN/C(=N/C)NCCS(C)(=O)=O)C(C)C |
| InChI | InChI=1S/C13H29N3O3S/c1-6-19-12(11(2)3)7-8-15-13(14-4)16-9-10-20(5,17)18/h11-12H,6-10H2,1-5H3,(H2,14,15,16) |
| InChIKey | QAWZLKUMDQUNMF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|