C19H40N4O2 — CID 111717474
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine (PubChem CID 111717474) has the molecular formula C19H40N4O2 and a molecular weight of 356.56 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111717474 |
| Molecular Formula | C19H40N4O2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.32 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine |
| SMILES | CCOC(CCN/C(=N\C)NCCCN1CC(C)OC(C)C1)C(C)C |
| InChI | InChI=1S/C19H40N4O2/c1-7-24-18(15(2)3)9-11-22-19(20-6)21-10-8-12-23-13-16(4)25-17(5)14-23/h15-18H,7-14H2,1-6H3,(H2,20,21,22) |
| InChIKey | LGPYXAOCAIGXDA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|