C18H27IN6O3 — CID 111592592
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 111592592) has the molecular formula C18H27IN6O3 and a molecular weight of 502.36 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111592592 |
| Molecular Formula | C18H27IN6O3 |
| Molecular Weight | 502.36 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ccc([N+](=O)[O-])cc1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C18H26N6O3.HI/c1-18(2,3)15-11-22-16(27-15)12-23-17(19-4)21-10-9-20-13-5-7-14(8-6-13)24(25)26;/h5-8,11,20H,9-10,12H2,1-4H3,(H2,19,21,23);1H |
| InChIKey | NJXSCCYQIDFSHI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|