C17H23F3IN5O — CID 111621305
1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111621305) has the molecular formula C17H23F3IN5O and a molecular weight of 497.30 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111621305 |
| Molecular Formula | C17H23F3IN5O |
| Molecular Weight | 497.30 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(C(F)(F)F)c1)NCc1noc(C(C)(C)C)n1.I |
| InChI | InChI=1S/C17H22F3N5O.HI/c1-16(2,3)14-24-13(25-26-14)10-23-15(21-4)22-9-11-6-5-7-12(8-11)17(18,19)20;/h5-8H,9-10H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | ALGABQNIYXFLOP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|