C22H24F3IN4OS — CID 111616033
2-methyl-1-[[3-(phenylmethoxymethyl)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616033) has the molecular formula C22H24F3IN4OS and a molecular weight of 576.43 g/mol. Its IUPAC name is 2-methyl-1-[[3-(phenylmethoxymethyl)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[3-(phenylmethoxymethyl)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616033 |
| Molecular Formula | C22H24F3IN4OS |
| Molecular Weight | 576.43 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | 2-methyl-1-[[3-(phenylmethoxymethyl)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(COCc2ccccc2)c1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C22H23F3N4OS.HI/c1-26-21(28-12-20-29-19(15-31-20)22(23,24)25)27-11-17-8-5-9-18(10-17)14-30-13-16-6-3-2-4-7-16;/h2-10,15H,11-14H2,1H3,(H2,26,27,28);1H |
| InChIKey | GXDCXMDNUORXDB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|