C18H22F3N5O2S — CID 111616234
N-ethyl-2-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide (PubChem CID 111616234) has the molecular formula C18H22F3N5O2S and a molecular weight of 429.47 g/mol. Its IUPAC name is N-ethyl-2-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide.
| Compound Name | N-ethyl-2-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111616234 |
| Molecular Formula | C18H22F3N5O2S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-ethyl-2-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide |
| SMILES | CCNC(=O)COc1cccc(CN/C(=N/C)NCc2nc(C(F)(F)F)cs2)c1 |
| InChI | InChI=1S/C18H22F3N5O2S/c1-3-23-15(27)10-28-13-6-4-5-12(7-13)8-24-17(22-2)25-9-16-26-14(11-29-16)18(19,20)21/h4-7,11H,3,8-10H2,1-2H3,(H,23,27)(H2,22,24,25) |
| InChIKey | LIEJITXDZAGBPU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|