C19H25F3IN5OS — CID 111615941
2-methyl-N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide (PubChem CID 111615941) has the molecular formula C19H25F3IN5OS and a molecular weight of 555.41 g/mol. Its IUPAC name is 2-methyl-N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide.
| Compound Name | 2-methyl-N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111615941 |
| Molecular Formula | C19H25F3IN5OS |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | 2-methyl-N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
| SMILES | CCC(C)C(=O)Nc1cccc(CN/C(=N/C)NCc2nc(C(F)(F)F)cs2)c1.I |
| InChI | InChI=1S/C19H24F3N5OS.HI/c1-4-12(2)17(28)26-14-7-5-6-13(8-14)9-24-18(23-3)25-10-16-27-15(11-29-16)19(20,21)22;/h5-8,11-12H,4,9-10H2,1-3H3,(H,26,28)(H2,23,24,25);1H |
| InChIKey | QDBFEVXGLOMLRY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|