C21H35N5O2S — CID 111142851
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111142851) has the molecular formula C21H35N5O2S and a molecular weight of 421.61 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111142851 |
| Molecular Formula | C21H35N5O2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCN(C)CC2)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H35N5O2S/c1-3-22-21(24-20-9-14-29(27,28)17-20)23-15-18-5-7-19(8-6-18)16-26-11-4-10-25(2)12-13-26/h5-8,20H,3-4,9-17H2,1-2H3,(H2,22,23,24) |
| InChIKey | ZPZFRZNMZUGCRF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|