C17H23N5O2S — CID 111143556
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine (PubChem CID 111143556) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111143556 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(-c2ccccc2)[nH]1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23N5O2S/c1-2-18-17(21-14-8-9-25(23,24)12-14)20-11-16-19-10-15(22-16)13-6-4-3-5-7-13/h3-7,10,14H,2,8-9,11-12H2,1H3,(H,19,22)(H2,18,20,21) |
| InChIKey | MBXFMAQXHZZTIU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|