C18H27N3 — CID 75532682
1-cyclohexyl-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine (PubChem CID 75532682) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-cyclohexyl-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 75532682 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 1-cyclohexyl-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine |
| SMILES | C/N=C(\NCC1(c2ccccc2)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C18H27N3/c1-19-17(21-16-10-6-3-7-11-16)20-14-18(12-13-18)15-8-4-2-5-9-15/h2,4-5,8-9,16H,3,6-7,10-14H2,1H3,(H2,19,20,21) |
| InChIKey | POUHCJGSUIQJBE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|